CAS 1234793-64-6 appears in our catalog under these names: 2-((4-(Hydroxymethyl)-3-methoxyphenyl)sulfinyl)acetic acid, 98%, Mmsb-OH Linker. Offered by: Chemat Brand, Iris Biotech. Available pack sizes: on request, 1g, 250mg.
2-[4-(hydroxymethyl)-3-methoxyphenyl]sulfinylacetic acid (CAS 1234793-64-6) is a chemical compound with the molecular formula C10H12O5S and a molecular weight of 244.27 g/mol. IUPAC name: 2-[4-(hydroxymethyl)-3-methoxyphenyl]sulfinylacetic acid. InChIKey: XXALTGPXHTYSPZ-UHFFFAOYSA-N.
| Molecular formula | C10H12O5S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 2-[4-(hydroxymethyl)-3-methoxyphenyl]sulfinylacetic acid |
| InChIKey | XXALTGPXHTYSPZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)S(=O)CC(=O)O)CO |
Computed by PubChem (NCBI)