Products 853799-71-0

CAS 853799-71-0 is the registry number for 3-((2,3-Dihydrothieno[3,4-b][1,4]dioxin-2-yl)methoxy)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)propanoic acid (CAS 853799-71-0) is a chemical compound with the molecular formula C10H12O5S and a molecular weight of 244.27 g/mol. IUPAC name: 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)propanoic acid. InChIKey: UHOCXHRRKZQUHK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O5S
Molecular weight244.27 g/mol
IUPAC name3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)propanoic acid
InChIKeyUHOCXHRRKZQUHK-UHFFFAOYSA-N
SMILESC1C(OC2=CSC=C2O1)COCCC(=O)O

Computed by PubChem (NCBI)