cas: 67475-56-3 — see every product listed under this CAS number, including other names
5-Fluoro-2-methoxybenzene-1-sulfonyl chloride 98% (CAS 67475-56-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A120369-5g |
| cas | 67475-56-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 25g | 298.06 Pln | |
| Ambeed | 100g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A120369 |
5-fluoro-2-methoxybenzenesulfonyl chloride (CAS 67475-56-3) is a chemical compound with the molecular formula C7H6ClFO3S and a molecular weight of 224.64 g/mol. IUPAC name: 5-fluoro-2-methoxybenzenesulfonyl chloride. InChIKey: LUEBMKPHZDSPFH-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO3S |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 5-fluoro-2-methoxybenzenesulfonyl chloride |
| InChIKey | LUEBMKPHZDSPFH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)