cas: 633327-50-1 — see every product listed under this CAS number, including other names
5-Fluoro-2-methyl-4-nitroaniline 98% (CAS 633327-50-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A204007-1g |
| cas | 633327-50-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 348.12 Pln | |
| Ambeed | 25g | 754.19 Pln | |
| Ambeed | 100g | 2178.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A204007 |
5-fluoro-2-methyl-4-nitroaniline (CAS 633327-50-1) is a chemical compound with the molecular formula C7H7FN2O2 and a molecular weight of 170.14 g/mol. IUPAC name: 5-fluoro-2-methyl-4-nitroaniline. InChIKey: RZRYLRYVZYEYNR-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O2 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 5-fluoro-2-methyl-4-nitroaniline |
| InChIKey | RZRYLRYVZYEYNR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)