cas: 633327-50-1 — see every product listed under this CAS number, including other names
5-Fluoro-2-methyl-4-nitroaniline, 95%, 95% (CAS 633327-50-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MQZ-1g |
| cas | 633327-50-1 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 256.40 Pln | |
| Chemat | 100g | 2066.00 Pln | |
| Chemat | 100mg | 78.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2-methyl-4-nitroaniline (CAS 633327-50-1) is a chemical compound with the molecular formula C7H7FN2O2 and a molecular weight of 170.14 g/mol. IUPAC name: 5-fluoro-2-methyl-4-nitroaniline. InChIKey: RZRYLRYVZYEYNR-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O2 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 5-fluoro-2-methyl-4-nitroaniline |
| InChIKey | RZRYLRYVZYEYNR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)