cas: 1096880-75-9 — see every product listed under this CAS number, including other names
5-Fluoro-2-morpholinobenzoic acid (CAS 1096880-75-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446611-1G |
| cas | 1096880-75-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1080.89 Pln | |
| Fluorochem | 5g | 4413.05 Pln |
| delivery time | 3-4 weeks |
|---|
5-fluoro-2-morpholin-4-ylbenzoic acid (CAS 1096880-75-9) is a chemical compound with the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. IUPAC name: 5-fluoro-2-morpholin-4-ylbenzoic acid. InChIKey: WNAOSSZZNGQFBY-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO3 |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | 5-fluoro-2-morpholin-4-ylbenzoic acid |
| InChIKey | WNAOSSZZNGQFBY-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)