5-Fluoro-2-nitroaniline, 98%
cas: 2369-11-1 — see every product listed under this CAS number, including other names
5-Fluoro-2-nitroaniline, 98% (CAS 2369-11-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 5g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A156514-10g |
| cas | 2369-11-1 |
| size | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 225.75 Pln | |
| Ambeed | 500g | 665.19 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 208.84 Pln | |
| BLDpharm | 25g | 236.61 Pln | |
| BLDpharm | 100g | 269.93 Pln | |
| BLDpharm | 500g | 658.68 Pln | |
| BLDpharm | 1kg | 1236.26 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-fluoro-2-nitroaniline (CAS 2369-11-1) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 5-fluoro-2-nitroaniline. InChIKey: PEDMFCHWOVJDNW-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 5-fluoro-2-nitroaniline |
| InChIKey | PEDMFCHWOVJDNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)