CAS 2369-11-1 appears in our catalog under these names: 5-Fluoro-2-nitroaniline, 97% , 5-Fluoro-2-nitroaniline, 5-Fluoro-2-nitroaniline, >98.0%(GC), 5-Fluoro-2-nitroaniline 98%. Offered by: Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 5g, 25g, 100g, 250g, 500g, 1000g, 10g.
5-fluoro-2-nitroaniline (CAS 2369-11-1) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 5-fluoro-2-nitroaniline. InChIKey: PEDMFCHWOVJDNW-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 5-fluoro-2-nitroaniline |
| InChIKey | PEDMFCHWOVJDNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)