cas: 703-95-7 — see every product listed under this CAS number, including other names
5-Fluoroorotic acid 96% (CAS 703-95-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A587031-1g |
| cas | 703-95-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 526.12 Pln | |
| Ambeed | 10g | 971.12 Pln | |
| Ambeed | 25g | 1877.81 Pln | |
| Ambeed | 100g | 6394.56 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A587031 |
5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 703-95-7) is a chemical compound with the molecular formula C5H3FN2O4 and a molecular weight of 174.09 g/mol. IUPAC name: 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: SEHFUALWMUWDKS-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O4 |
|---|---|
| Molecular weight | 174.09 g/mol |
| IUPAC name | 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| InChIKey | SEHFUALWMUWDKS-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)C(=O)O)F |
Computed by PubChem (NCBI)