CAS 1060802-47-2 appears in our catalog under these names: 5-Fluoro-2-pyridinesulfonyl Chloride, 5-Fluoropyridine-2-sulfonyl chloride, 95%, 5-Fluoro-2-pyridinesulfonyl Chloride, 95%, 95%. Offered by: TRC, Fluorochem, Chemat. Available pack sizes: 500mg, 250mg, 1g, 50mg, 100mg.
5-fluoropyridine-2-sulfonyl chloride (CAS 1060802-47-2) is a chemical compound with the molecular formula C5H3ClFNO2S and a molecular weight of 195.60 g/mol. IUPAC name: 5-fluoropyridine-2-sulfonyl chloride. InChIKey: YPUCBCYWMHYLMA-UHFFFAOYSA-N.
| Molecular formula | C5H3ClFNO2S |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-fluoropyridine-2-sulfonyl chloride |
| InChIKey | YPUCBCYWMHYLMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)