CAS 1060802-49-4 is the registry number for 5-Fluoropyridine-3-Sulfonyl Chloride. Offered by: TRC, Biosynth. Available pack sizes: 5g, 0,05g.
5-fluoropyridine-3-sulfonyl chloride (CAS 1060802-49-4) is a chemical compound with the molecular formula C5H3ClFNO2S and a molecular weight of 195.60 g/mol. IUPAC name: 5-fluoropyridine-3-sulfonyl chloride. InChIKey: FSAMEVYXVKKALC-UHFFFAOYSA-N.
| Molecular formula | C5H3ClFNO2S |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-fluoropyridine-3-sulfonyl chloride |
| InChIKey | FSAMEVYXVKKALC-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)