Products 1060802-49-4

CAS 1060802-49-4 is the registry number for 5-Fluoropyridine-3-Sulfonyl Chloride. Offered by: TRC, Biosynth. Available pack sizes: 5g, 0,05g.

Structural formula: {0} (CAS {1})

5-fluoropyridine-3-sulfonyl chloride (CAS 1060802-49-4) is a chemical compound with the molecular formula C5H3ClFNO2S and a molecular weight of 195.60 g/mol. IUPAC name: 5-fluoropyridine-3-sulfonyl chloride. InChIKey: FSAMEVYXVKKALC-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3ClFNO2S
Molecular weight195.60 g/mol
IUPAC name5-fluoropyridine-3-sulfonyl chloride
InChIKeyFSAMEVYXVKKALC-UHFFFAOYSA-N
SMILESC1=C(C=NC=C1S(=O)(=O)Cl)F

Computed by PubChem (NCBI)