CAS 1780694-70-3 appears in our catalog under these names: 5-Chloropyridine-2-sulfonyl fluoride 95%, 5-Chloropyridine-2-sulfonyl fluoride, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloropyridine-2-sulfonyl fluoride (CAS 1780694-70-3) is a chemical compound with the molecular formula C5H3ClFNO2S and a molecular weight of 195.60 g/mol. IUPAC name: 5-chloropyridine-2-sulfonyl fluoride. InChIKey: TUILXSYMSYXYSW-UHFFFAOYSA-N.
| Molecular formula | C5H3ClFNO2S |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-chloropyridine-2-sulfonyl fluoride |
| InChIKey | TUILXSYMSYXYSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)S(=O)(=O)F |
Computed by PubChem (NCBI)