CAS 1089330-70-0 appears in our catalog under these names: 2-Fluoro-pyridine-3-sulfonyl chloride, 95%, 2-Fluoropyridine-3-sulfonyl chloride, 95%, 2-Fluoro-pyridine-3-sulphonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 0,5g, 2g.
2-fluoropyridine-3-sulfonyl chloride (CAS 1089330-70-0) is a chemical compound with the molecular formula C5H3ClFNO2S and a molecular weight of 195.60 g/mol. IUPAC name: 2-fluoropyridine-3-sulfonyl chloride. InChIKey: MSOAVTSXBMHOEM-UHFFFAOYSA-N.
| Molecular formula | C5H3ClFNO2S |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 2-fluoropyridine-3-sulfonyl chloride |
| InChIKey | MSOAVTSXBMHOEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)