CAS 128583-07-3 appears in our catalog under these names: 6-Fluoropyridine-2-sulfonyl chloride, 96%, 6-Fluoropyridine-2-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 10g.
6-fluoropyridine-2-sulfonyl chloride (CAS 128583-07-3) is a chemical compound with the molecular formula C5H3ClFNO2S and a molecular weight of 195.60 g/mol. IUPAC name: 6-fluoropyridine-2-sulfonyl chloride. InChIKey: ZYYNYUDHGGZBOB-UHFFFAOYSA-N.
| Molecular formula | C5H3ClFNO2S |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 6-fluoropyridine-2-sulfonyl chloride |
| InChIKey | ZYYNYUDHGGZBOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)