cas: 13589-74-7 — see every product listed under this CAS number, including other names
5-Hydroxy-2-nitrobenzonitrile 98% (CAS 13589-74-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A141794-250mg |
| cas | 13589-74-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2506.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A141794 |
5-hydroxy-2-nitrobenzonitrile (CAS 13589-74-7) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 5-hydroxy-2-nitrobenzonitrile. InChIKey: IVDZYHBBWXCWGN-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 5-hydroxy-2-nitrobenzonitrile |
| InChIKey | IVDZYHBBWXCWGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)