cas: 75291-74-6 — see every product listed under this CAS number, including other names
5-Hydroxy-7-methoxy-2-phenylchroman-4-one 97% (CAS 75291-74-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A317697-1mg |
| cas | 75291-74-6 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 303.62 Pln | |
| Ambeed | 5mg | 565.06 Pln | |
| Ambeed | 10mg | 804.25 Pln | |
| Ambeed | 25mg | 1510.69 Pln | |
| Ambeed | 50mg | 2528.62 Pln | |
| Ambeed | 100mg | 3368.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A317697 |
5-hydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one (CAS 75291-74-6) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 5-hydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one. InChIKey: ORJDDOBAOGKRJV-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 5-hydroxy-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one |
| InChIKey | ORJDDOBAOGKRJV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=O)CC(OC2=C1)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)