CAS 32604-29-8 appears in our catalog under these names: 4,4'-Diacetoxybiphenyl, 98%, (1,1'-Biphenyl)-4,4'-diyl diacetate, 99%, 4,4'-Diacetoxybiphenyl, >99.0%(GC), [1,1'-Biphenyl]-4,4'-diyl diacetate. Offered by: Combi-blocks, AmBeed, TCI, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 500g.
[4-(4-acetyloxyphenyl)phenyl] acetate (CAS 32604-29-8) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: [4-(4-acetyloxyphenyl)phenyl] acetate. InChIKey: RQMBBMQDXFZFCC-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | [4-(4-acetyloxyphenyl)phenyl] acetate |
| InChIKey | RQMBBMQDXFZFCC-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=CC=C(C=C2)OC(=O)C |
Computed by PubChem (NCBI)