CAS 34221-41-5 appears in our catalog under these names: Echinatin, Echinatin, 95%, Echinatin/ 98.12% (existing batch purity), Echinatin (Standard), Echinatin, 99.83%. Offered by: GLPBio, Combi-blocks, TRC, TargetMol, Biosynth. Available pack sizes: 5mg, 100mg, 50mg, 20mg, 1mg, 10mg, 25mg, 500mg.
(E)-3-(4-hydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one (CAS 34221-41-5) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: (E)-3-(4-hydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: QJKMIJNRNRLQSS-WEVVVXLNSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (E)-3-(4-hydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | QJKMIJNRNRLQSS-WEVVVXLNSA-N |
| SMILES | COC1=C(C=CC(=C1)O)/C=C/C(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)