Products 400750-15-4
CAS 400750-15-4 is the registry number for 2'-(1,3-Dioxolan-2-yl)biphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[2-(1,3-dioxolan-2-yl)phenyl]benzoic acid (CAS 400750-15-4) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 3-[2-(1,3-dioxolan-2-yl)phenyl]benzoic acid. InChIKey: POQPRIGYDJGXPC-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 3-[2-(1,3-dioxolan-2-yl)phenyl]benzoic acid |
| InChIKey | POQPRIGYDJGXPC-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC=CC=C2C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)