Products 205760-31-2
CAS 205760-31-2 appears in our catalog under these names: Alpha-carboxy-4-hydroxy-3'-methoxystilbene, 95%, α-Carboxy-4-hydroxy-3'-methoxystilbene, α-Carboxy-4-hydroxy-3'-methoxystilbene, min. 95 %, 25 g, α-Carboxy-4-hydroxy-3'-methoxystilbene, min. 95 %, 50 g, α-Carboxy-4-hydroxy-3'-methoxystilbene, min. 95 %, 100 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 1g, 100g, 25g, 5g, 50g, 250g.
(E)-2-(4-hydroxyphenyl)-3-(3-methoxyphenyl)prop-2-enoic acid (CAS 205760-31-2) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: (E)-2-(4-hydroxyphenyl)-3-(3-methoxyphenyl)prop-2-enoic acid. InChIKey: GNUSAQYVYXEFIL-XNTDXEJSSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (E)-2-(4-hydroxyphenyl)-3-(3-methoxyphenyl)prop-2-enoic acid |
| InChIKey | GNUSAQYVYXEFIL-XNTDXEJSSA-N |
| SMILES | COC1=CC=CC(=C1)/C=C(\C2=CC=C(C=C2)O)/C(=O)O |
Computed by PubChem (NCBI)