5-Hydroxyflavone, 98%
cas: 491-78-1 — see every product listed under this CAS number, including other names
5-Hydroxyflavone, 98% (CAS 491-78-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 50mg, 100mg, 500mg. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A842385-250mg |
| cas | 491-78-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1577.44 Pln | |
| Ambeed | 10g | 2484.12 Pln | |
| Fluorochem | 50mg | 180.16 Pln | |
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 500mg | 404.04 Pln | |
| Fluorochem | 1g | 570.65 Pln | |
| Fluorochem | 5g | 1856.66 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-hydroxy-2-phenylchromen-4-one (CAS 491-78-1) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 5-hydroxy-2-phenylchromen-4-one. InChIKey: IYBLVRRCNVHZQJ-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 5-hydroxy-2-phenylchromen-4-one |
| InChIKey | IYBLVRRCNVHZQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(C=CC=C3O2)O |
Computed by PubChem (NCBI)