Products 53921-70-3
CAS 53921-70-3 appears in our catalog under these names: Dibenzo[b,f]oxepine-10-carboxylic acid, 95%, Dibenzo(b,f)oxepine-10-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Benzo[b][1]benzoxepine-5-carboxylic acid (CAS 53921-70-3) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: benzo[b][1]benzoxepine-5-carboxylic acid. InChIKey: BBBADFKCXHGXLZ-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | benzo[b][1]benzoxepine-5-carboxylic acid |
| InChIKey | BBBADFKCXHGXLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C3=CC=CC=C3O2)C(=O)O |
Computed by PubChem (NCBI)