CAS 491-78-1 appears in our catalog under these names: 5-Hydroxyflavone/ 99.21% (existing batch purity), 5–Hydroxyflavone, 5-Hydroxyflavone, 97% , 5-Hydroxyflavone, 5-Hydroxyflavone, >98.0%(HPLC)(T). Offered by: TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25mg, 100mg, 500mg, 1g, 10g, 250mg, 5g, 50mg.
5-hydroxy-2-phenylchromen-4-one (CAS 491-78-1) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 5-hydroxy-2-phenylchromen-4-one. InChIKey: IYBLVRRCNVHZQJ-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 5-hydroxy-2-phenylchromen-4-one |
| InChIKey | IYBLVRRCNVHZQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(C=CC=C3O2)O |
Computed by PubChem (NCBI)