Products 643-75-4
CAS 643-75-4 appears in our catalog under these names: 1,3-Diphenylpropanetrione, 95%, 1，3–Diphenylpropanetrione, 1,3-Diphenylpropane-1,2,3-trione 95% （contains~10.0% hydrate）, 1,3-Diphenylpropane-1,2,3-trione, 95% （contains~10.0% hydrate）, 95% （contains~10.0% hydrate）, 1,3-Diphenylpropane-1,2,3-trione, 98%+,RG. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 200mg.
1,3-diphenylpropane-1,2,3-trione (CAS 643-75-4) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 1,3-diphenylpropane-1,2,3-trione. InChIKey: RXVBJUZEFSAYPW-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 1,3-diphenylpropane-1,2,3-trione |
| InChIKey | RXVBJUZEFSAYPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)