CAS 6468-96-8 appears in our catalog under these names: 7-Hydroxy-3-phenyl-2h-chromen-2-one, 95%, 3–Phenylumbelliferone, 3-Phenylumbelliferone, >98.0%(GC), 3-Phenylumbelliferone, 7-Hydroxy-3-phenyl-2H-chromen-2-one 95%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 500mg, 2,5g, 250mg, 100mg, 10g.
7-hydroxy-3-phenylchromen-2-one (CAS 6468-96-8) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 7-hydroxy-3-phenylchromen-2-one. InChIKey: RIPZCQZTVDNJHQ-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 7-hydroxy-3-phenylchromen-2-one |
| InChIKey | RIPZCQZTVDNJHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C(C=C3)O)OC2=O |
Computed by PubChem (NCBI)