5-Mercapto-2-nitrobenzoic acid, 95%
cas: 15139-21-6 — see every product listed under this CAS number, including other names
5-Mercapto-2-nitrobenzoic acid, 95% (CAS 15139-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A305903-100mg |
| cas | 15139-21-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 659.62 Pln | |
| Ambeed | 250mg | 1065.69 Pln | |
| Ambeed | 1g | 2740.00 Pln | |
| BLDpharm | 100mg | 647.57 Pln | |
| BLDpharm | 250mg | 1047.43 Pln | |
| BLDpharm | 1g | 2691.30 Pln | |
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 779.60 Pln | |
| Chemat | 1g | 2003.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-nitro-5-sulfanylbenzoic acid (CAS 15139-21-6) is a chemical compound with the molecular formula C7H5NO4S and a molecular weight of 199.19 g/mol. IUPAC name: 2-nitro-5-sulfanylbenzoic acid. InChIKey: GANZODCWZFAEGN-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4S |
|---|---|
| Molecular weight | 199.19 g/mol |
| IUPAC name | 2-nitro-5-sulfanylbenzoic acid |
| InChIKey | GANZODCWZFAEGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
