cas: 17288-36-7 — see every product listed under this CAS number, including other names
5-Methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid, 97%, 97% (CAS 17288-36-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AP59-100mg |
| cas | 17288-36-7 |
| size | 100mg |
| availability | 5.81g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 1130.00 Pln | |
| Chemat | 5g | 2910.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid (CAS 17288-36-7) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid. InChIKey: FDTMPCXUIHRSEB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid |
| InChIKey | FDTMPCXUIHRSEB-UHFFFAOYSA-N |
| SMILES | COC1=NC=C2C(=C1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)