cas: 89791-96-8 — see every product listed under this CAS number, including other names
5-Methyl-3-nitrobenzene-1,2-diol 97% (CAS 89791-96-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1151457-50mg |
| cas | 89791-96-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 259.12 Pln | |
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1766.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1151457 |
5-methyl-3-nitrocatechol is a methylcatechol that is 3-nitrocatechol carrying a methyl substituent at position 5. It is a methylcatechol and a nitrotoluene.
Source: ChEBI
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 5-methyl-3-nitrobenzene-1,2-diol |
| InChIKey | MQGZDMVKFBSAQP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)