cas: 16883-16-2 — see every product listed under this CAS number, including other names
5-Methyl-3-phenylisoxazole-4-carbonyl chloride 98% (CAS 16883-16-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A775980-5g |
| cas | 16883-16-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 197.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A775980 |
5-methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride (CAS 16883-16-2) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 5-methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride. InChIKey: HXEVQMXCHCDPSO-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 5-methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride |
| InChIKey | HXEVQMXCHCDPSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)