cas: 72966-19-9 — see every product listed under this CAS number, including other names
5-Methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine 95+% (CAS 72966-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A753067-100mg |
| cas | 72966-19-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 726.38 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A753067 |
5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (CAS 72966-19-9) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine. InChIKey: ZCOHGHCESYZASH-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| InChIKey | ZCOHGHCESYZASH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=NN2C(=C1)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)