CAS 4261-14-7 appears in our catalog under these names: 9-Benzyladenine, 97%, 9-Benzyladenine, >95% (HPLC), 9–Benzyl–9H–purin–6–amine, N9-Benzyladenine, 9-BENZYLADENINE, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 2,5g, 500mg, 1000mg.
9-benzylpurin-6-amine (CAS 4261-14-7) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 9-benzylpurin-6-amine. InChIKey: MRHCSNNEUHXNIC-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 9-benzylpurin-6-amine |
| InChIKey | MRHCSNNEUHXNIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)