cas: 72966-19-9 — see every product listed under this CAS number, including other names
5-Methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-ylamine, 95% (CAS 72966-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F025185-100MG |
| cas | 72966-19-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 440.49 Pln | |
| Fluorochem | 1g | 1080.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (CAS 72966-19-9) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine. InChIKey: ZCOHGHCESYZASH-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| InChIKey | ZCOHGHCESYZASH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=NN2C(=C1)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)