Products 5444-61-1
CAS 5444-61-1 appears in our catalog under these names: 1-Benzyl-1h-pyrazolo[3,4-d]pyrimidin-4-amine, 95%, 1-Benzyl-1H-Pyrazolo[3,4-D]Pyrimidin-4-Amine, 96%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
1-benzylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 5444-61-1) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 1-benzylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: MFJROXVGGWPNPO-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 1-benzylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | MFJROXVGGWPNPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=NC=NC(=C3C=N2)N |
Computed by PubChem (NCBI)