cas: 72966-19-9 — see every product listed under this CAS number, including other names
5-Methyl-7-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-2-amine, 95+%, 95+% (CAS 72966-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FB1L-100mg |
| cas | 72966-19-9 |
| size | 100mg |
| availability | 11g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 933.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (CAS 72966-19-9) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine. InChIKey: ZCOHGHCESYZASH-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| InChIKey | ZCOHGHCESYZASH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=NN2C(=C1)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)