cas: 2306272-04-6 — see every product listed under this CAS number, including other names
5-Methylindolin-7-amine dihydrochloride, 97%, 97% (CAS 2306272-04-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUMS-100mg |
| cas | 2306272-04-6 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 602.00 Pln | |
| Chemat | 250mg | 962.00 Pln | |
| Chemat | 500mg | 1355.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-methyl-2,3-dihydro-1H-indol-7-amine;dihydrochloride (CAS 2306272-04-6) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 5-methyl-2,3-dihydro-1H-indol-7-amine;dihydrochloride. InChIKey: OWNFLUPAQULYDY-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 5-methyl-2,3-dihydro-1H-indol-7-amine;dihydrochloride |
| InChIKey | OWNFLUPAQULYDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)N)NCC2.Cl.Cl |
Computed by PubChem (NCBI)