CAS 2306272-04-6 appears in our catalog under these names: 5-Methylindolin-7-amine dihydrochloride, 95%, 5-Methylindolin-7-amine dihydrochloride, 97%, 5-Methylindolin-7-amine dihydrochloride, 5-Methylindolin-7-amine dihydrochloride, 97%, 97%, 5-Methylindolin-7-amine dihydrochloride, min. 95 %, 50 mg. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Roth. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg, 50mg, 1000mg, 500mg.
5-methyl-2,3-dihydro-1H-indol-7-amine;dihydrochloride (CAS 2306272-04-6) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 5-methyl-2,3-dihydro-1H-indol-7-amine;dihydrochloride. InChIKey: OWNFLUPAQULYDY-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 5-methyl-2,3-dihydro-1H-indol-7-amine;dihydrochloride |
| InChIKey | OWNFLUPAQULYDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)N)NCC2.Cl.Cl |
Computed by PubChem (NCBI)