cas: 2306272-04-6 — see every product listed under this CAS number, including other names
5-Methylindolin-7-amine dihydrochloride, 97% (CAS 2306272-04-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1225184-1g |
| cas | 2306272-04-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 7009.66 Pln | |
| AmBeed | 10g | 25159.54 Pln | |
| AmBeed | 5g | 20804.35 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-methyl-2,3-dihydro-1H-indol-7-amine;dihydrochloride (CAS 2306272-04-6) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 5-methyl-2,3-dihydro-1H-indol-7-amine;dihydrochloride. InChIKey: OWNFLUPAQULYDY-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 5-methyl-2,3-dihydro-1H-indol-7-amine;dihydrochloride |
| InChIKey | OWNFLUPAQULYDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)N)NCC2.Cl.Cl |
Computed by PubChem (NCBI)