cas: 2047-49-6 — see every product listed under this CAS number, including other names
5-Nitronicotinic acid, 98%, 98% (CAS 2047-49-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1130NP-10g |
| cas | 2047-49-6 |
| size | 10g |
| availability | 6300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1787.60 Pln | |
| Chemat | 100g | 4643.60 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 410.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-nitropyridine-3-carboxylic acid (CAS 2047-49-6) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 5-nitropyridine-3-carboxylic acid. InChIKey: TZAGBVHIUUFVCJ-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 5-nitropyridine-3-carboxylic acid |
| InChIKey | TZAGBVHIUUFVCJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)