cas: 49597-17-3 — see every product listed under this CAS number, including other names
5-Oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylic acid 95+% (CAS 49597-17-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A294752-250mg |
| cas | 49597-17-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1076.81 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A294752 |
3-oxo-2-phenyl-1H-pyrazole-5-carboxylic acid (CAS 49597-17-3) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 3-oxo-2-phenyl-1H-pyrazole-5-carboxylic acid. InChIKey: SIVDWYOIVRKZPG-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-oxo-2-phenyl-1H-pyrazole-5-carboxylic acid |
| InChIKey | SIVDWYOIVRKZPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)