CAS 49597-17-3 appears in our catalog under these names: 5-Oxo-1-phenyl-2,5-dihydro-1h-pyrazole-3-carboxylic acid, 95%, 5-Oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylic acid 95+%, 5-Oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylic acid, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg.
3-oxo-2-phenyl-1H-pyrazole-5-carboxylic acid (CAS 49597-17-3) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 3-oxo-2-phenyl-1H-pyrazole-5-carboxylic acid. InChIKey: SIVDWYOIVRKZPG-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-oxo-2-phenyl-1H-pyrazole-5-carboxylic acid |
| InChIKey | SIVDWYOIVRKZPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)