Products 938000-13-6

CAS 938000-13-6 is the registry number for 3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxylic acid (CAS 938000-13-6) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxylic acid. InChIKey: OMSRWAXHRVPMCC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8N2O3
Molecular weight204.18 g/mol
IUPAC name3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxylic acid
InChIKeyOMSRWAXHRVPMCC-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=NOC(=N2)C(=O)O

Computed by PubChem (NCBI)