CAS 938000-13-6 is the registry number for 3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxylic acid (CAS 938000-13-6) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxylic acid. InChIKey: OMSRWAXHRVPMCC-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxylic acid |
| InChIKey | OMSRWAXHRVPMCC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=N2)C(=O)O |
Computed by PubChem (NCBI)