Products 87613-40-9
CAS 87613-40-9 appears in our catalog under these names: 2-(2-Cyano-acetylamino)-benzoic acid, 95%, 2-(2-Cyanoacetamido)benzoic acid, 97%, 2-(2-Cyanoacetamido)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[(2-cyanoacetyl)amino]benzoic acid (CAS 87613-40-9) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 2-[(2-cyanoacetyl)amino]benzoic acid. InChIKey: LNMDMNGHWPNZBO-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 2-[(2-cyanoacetyl)amino]benzoic acid |
| InChIKey | LNMDMNGHWPNZBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)CC#N |
Computed by PubChem (NCBI)