CAS 93284-13-0 appears in our catalog under these names: 1-(4-Methylphenyl)imidazolidine-2,4,5-trione, 95%, 1-(p-Tolyl)imidazolidine-2,4,5-trione, 97%, 1-(4-Methylphenyl)imidazolidine-2,4,5-trione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
1-(4-methylphenyl)imidazolidine-2,4,5-trione (CAS 93284-13-0) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 1-(4-methylphenyl)imidazolidine-2,4,5-trione. InChIKey: HYKHCZXGWLVTAL-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 1-(4-methylphenyl)imidazolidine-2,4,5-trione |
| InChIKey | HYKHCZXGWLVTAL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)C(=O)NC2=O |
Computed by PubChem (NCBI)