cas: 22971-62-6 — see every product listed under this CAS number, including other names
5-Oxo-5-(2-thienyl)valeric acid (CAS 22971-62-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F022948-1G |
| cas | 22971-62-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 10g | 674.78 Pln |
| delivery time | 2-3 weeks |
|---|
5-oxo-5-thiophen-2-ylpentanoic acid (CAS 22971-62-6) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 5-oxo-5-thiophen-2-ylpentanoic acid. InChIKey: GSQMRVFOHNXKOR-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 5-oxo-5-thiophen-2-ylpentanoic acid |
| InChIKey | GSQMRVFOHNXKOR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)CCCC(=O)O |
Computed by PubChem (NCBI)