CAS 22971-62-6 appears in our catalog under these names: 5-Oxo-5-(2-thienyl)valeric acid, 95%, 5-Oxo-5-(thiophen-2-yl)pentanoic acid, 98%, 5-Oxo-5-(thiophen-2-yl)pentanoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g.
5-oxo-5-thiophen-2-ylpentanoic acid (CAS 22971-62-6) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 5-oxo-5-thiophen-2-ylpentanoic acid. InChIKey: GSQMRVFOHNXKOR-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 5-oxo-5-thiophen-2-ylpentanoic acid |
| InChIKey | GSQMRVFOHNXKOR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)CCCC(=O)O |
Computed by PubChem (NCBI)