Products 1027730-68-2

CAS 1027730-68-2 is the registry number for 3-(Methylsulfinyl)phenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3-methylsulfinylphenyl)acetic acid (CAS 1027730-68-2) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 2-(3-methylsulfinylphenyl)acetic acid. InChIKey: DXFCQIDRHQFCHE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10O3S
Molecular weight198.24 g/mol
IUPAC name2-(3-methylsulfinylphenyl)acetic acid
InChIKeyDXFCQIDRHQFCHE-UHFFFAOYSA-N
SMILESCS(=O)C1=CC=CC(=C1)CC(=O)O

Computed by PubChem (NCBI)