CAS 959237-71-9 is the registry number for 5-(Tetrahydrofuran-2-yl)thiophene-2-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
5-(oxolan-2-yl)thiophene-2-carboxylic acid (CAS 959237-71-9) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 5-(oxolan-2-yl)thiophene-2-carboxylic acid. InChIKey: MTRSGCTYMNSNSD-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 5-(oxolan-2-yl)thiophene-2-carboxylic acid |
| InChIKey | MTRSGCTYMNSNSD-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)