CAS 156867-56-0 appears in our catalog under these names: 4-((Methylsulfonyl)methyl)benzaldehyde, 95%, 4–((Methylsulfonyl)methyl)benzaldehyde. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
4-(methylsulfonylmethyl)benzaldehyde (CAS 156867-56-0) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 4-(methylsulfonylmethyl)benzaldehyde. InChIKey: RUZRGRDECVOHGI-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 4-(methylsulfonylmethyl)benzaldehyde |
| InChIKey | RUZRGRDECVOHGI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)