cas: 3004-42-0 — see every product listed under this CAS number, including other names
5-Phenyl-1,3,4-oxadiazole-2(3H)-thione, 98+%, 98+% (CAS 3004-42-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MY7-5g |
| cas | 3004-42-0 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 131.60 Pln | |
| Chemat | 25g | 309.20 Pln | |
| Chemat | 100g | 957.20 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
5-phenyl-3H-1,3,4-oxadiazole-2-thione (CAS 3004-42-0) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 5-phenyl-3H-1,3,4-oxadiazole-2-thione. InChIKey: FOHWXVBZGSVUGO-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 5-phenyl-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | FOHWXVBZGSVUGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)