cas: 3414-94-6 — see every product listed under this CAS number, including other names
5-Phenyl-1H-1,2,4-triazole-3-thiol, 98%, 98% (CAS 3414-94-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MY8-250mg |
| cas | 3414-94-6 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 414.80 Pln | |
| Chemat | 10g | 765.20 Pln | |
| Chemat | 25g | 1816.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione (CAS 3414-94-6) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: JRLMMJNORORYPO-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | JRLMMJNORORYPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)